Mafi kyawun Urolithin B foda (1139-83-9) Manufacturer & factory

Urolithin B foda

Nuwamba 9, 2020

Cofttek shine mafi kyawun masana'antar foda Urolithin B a China. Masana'antarmu tana da cikakken tsarin sarrafa sarrafawa (ISO9001 & ISO14001), tare da damar samarwa kowane wata na 200kg.

 


Status: A Mass Production
Naúra: 1kg / jaka, 25kg / Drum

Urolithin BSfasali

name: Urolithin B.
Chemical Name: 3-Hydroxy-6H-dibenzo [b, d] pyran-6-daya
CAS: 1139-83-9
Tsarin Kiba: C13H8O3
Girman kwayoyin halitta: 212.2 g / mol
Color:  White foda
Makullin InChi: WXUQMTRHPNOXBV-UHFFFAOYSA-N
Lambar ta SMILES: O=C1C2=CC=CC=C2C3=CC=C(O)C=C3O1
aiki: Urolithin B na iya haɓaka aikin mitochondrial da aikin tsoka.

Urolithin B na iya inganta ƙarfin tsoka da juriya yayin tsufa.

Application: Urolithin B shine ƙwayar ƙwayar ƙwayar ƙwayar cuta na hanji na ellagitannis kuma yana nuna ƙarfin anti-oxidant da ayyukan pro-oxidant dangane da tsarin assay da yanayin. Urolithin B zai iya nuna aikin estrogenic da / ko anti-estrogenic aiki.
Solubility: Sauƙaƙa mai narkewa a cikin N, N-dimethylformamide da dimethylmethylene. Sulfone, dan kadan mai narkewa a methanol, ethanol, da acylate ethyl
Ajiye Temp: Hygroscopic, -20 ° C Freezer, A ƙarƙashin yanayin yanayi
Yanayin Jira: An shigo da su a ƙarƙashin zazzabi mai zafi azaman ƙwayoyin ƙwayoyi marasa haɗari. Wannan samfurin yana da ƙidayar isa ga 'yan makonni a yayin aikawa na kyauta da lokacin da aka kashe a Kwastam.

 

Urolithin B. Bayanin NMR

Urolithin B (1139-83-9) - NMR Bakan

 

Idan kuna buƙatar COA, MSDS, HNMR don kowane samfurin samfur da sauran bayanai, da fatan za a tuntuɓi mu manajan talla.

 

Gabatarwa zuwa Urolithins

Urolithins su ne na biyu na metabolites na ellagic acid da aka samo daga ellagitannins. A cikin mutane ellagitannins suna canzawa ta hanji microflora zuwa ellagic acid wanda ke kara canzawa zuwa urolithins A, urolithin B, urolithin C da urolithin D a cikin manyan hanji.

Urolithin A (UA) shine mafi yawan yaduwar abubuwa na ellagitannins. Koyaya, urolithin A ba a san shi da faruwa ta ɗabi'a a kowace tushen abinci ba.

Urolithin B (UB) yana da wadataccen kwayar halitta wanda aka samar a cikin hanji ta hanyar canji na ellagitannins. Urolithin B shine samfurin ƙarshe bayan duk sauran urolithin sun samo asali. Ana samun Urolithin B a cikin fitsari a matsayin urolithin B glucuronide.

Urolithin A 8-Methyl Ether shine matsakaiciyar samfur yayin kiran Urolithin A. Yana da mahimmancin ci gaba na biyu na ellagitannin kuma yana da abubuwan antioxidant da anti-inflammatory.

 

Tsarin aikin urolithin A da B

Rol Urolithin A yana haifar da mitophagy

Mitophagy nau'i ne na cin gashin kansa wanda ke taimakawa kawar da lalacewar mitochondrial don ingantaccen aikin su. Autophagy yana nufin babban tsari wanda lalacewar abubuwan cytoplasmic kuma saboda haka ana sake yin amfani dasu yayin da mitophagy shine lalata da kuma sake amfani da mitochondria.

Yayin tsufa raguwa a cikin motsa jiki wani bangare ne da ke haifar da raguwar aikin mitochondrial. Bugu da ari, danniya da karfin jiki na iya haifar da karancin motsa jiki. Urolithin A sun mallaki ikon kawar da lalacewar mitochondria ta hanyar amfani da iska.

Properties Abubuwan antioxidant

Oxidative danniya na faruwa lokacin da akwai rashin daidaituwa tsakanin tsatstsauran ra'ayi kyauta da antioxidant a jiki. Wadannan tsattsauran ra'ayi ba sau da yawa ana danganta su da cututtukan cututtukan cututtukan cututtukan zuciya, cututtukan zuciya da ciwon daji.

Urolithins A da B suna nuna tasirin antioxidant ta hanyar ƙarfin su na rage radicals kuma takamaiman matakan oxygen nau'in oxygen (ROS) kuma suna hana peroxidation lipid a cikin wasu nau'ikan sel.

Bugu da ari, urolithins suna iya hana wasu enzymes masu shayarwa, gami da monoamine oxidase A da tyrosinase.

● Abubuwan kariya ga kumburi

Kumburi tsari ne na halitta wanda jikinmu ke yaƙi da duk wani abu da ya faɗi kamar cututtuka, rauni, da ƙananan ƙwayoyin cuta. Koyaya, ciwon kumburi na yau da kullun na iya zama cutarwa ga jiki saboda wannan yana da alaƙa da cuta daban-daban kamar asma, matsalolin zuciya, da kuma cutar kansa. Konewa na yau da kullun na iya faruwa saboda mummunan kumburi, cututtuka ko ma masu kyauta a jiki.

Urolithins A da B sun nuna kaddarorin anti-kumburi ta hanyar hana sinadarin nitric oxide. Suna hana takamaiman sinadarin nitric oxide synthase (iNOS) takaddama da mRNA wanda ke da alhakin kumburi.

Effects Tasirin anti-microbial

Beswayoyin cuta da suka haɗa da ƙwayoyin cuta, fungi da ƙwayoyin cuta suna faruwa ta halitta a cikin yanayi har ma a jikin mutum. Koyaya, microan ƙananan ƙwayoyin cuta da ake magana da su a matsayin ƙwayoyin cuta na iya haifar da cututtukan cututtuka kamar mura, kyanda da malaria.

Urolithin A da B sun iya yin aikin antimicrobial ta hanyar hana ƙwayar kokwamba. Kirkiro ƙwayoyin cuta shine yanayin sadarwa na ƙwayoyin cuta wanda ke sa ƙwayoyin ƙwayoyin cuta don ganowa da sarrafa abubuwan da suka shafi kamuwa da cuta kamar virulence da motility.

Hib Hana glycation mai gina jiki

Glycation yana nufin haɗuwa marar haɗari na enzymatic na sukari zuwa lipid ko furotin. Babban jigon kayan tarihi ne a cikin masu cutar sukari da sauran rikice-rikice har da tsufa.

Babban ƙwayar glycation shine tasirin sakandare na hyperglycemia yana da babban matsayi a cikin rikice-rikicen cututtukan zuciya kamar su ciwon sukari da cutar Alzheimer.

Urolithin A da B sun mallaki kaddarorin anti-glycative wadanda suke dogaro da kansu wadanda basu da izinin aikin antioxidant.

 

Amfanin Urolithin B

Abubuwan Urolithin B suma suna da fa'idodin kiwon lafiya da yawa kuma mafi yawansu suna kama da amfanin urolithin A.

(1) Karfin cutar kansa
Abubuwan rigakafin ƙwayar kumburi na urolithin B ya sa ya zama ɗan takara nagari don yaƙi da cutar kansa. Wasu masu binciken sun ba da rahoton waɗannan damar a cikin ƙwayoyin fibroblasts, microphages da ƙwayoyin endothelial.

Nazarin sun ba da rahoton cewa UB yana hana nau'o'in cututtukan daji daban daban kamar su prostate, colon da cancer na mafitsara.

A cikin binciken da ya shafi sel kwayoyin cutar kansa, ellagitannins, ellagic acid da urolithins A da B sun kimanta yiwuwar maganin cutar kansa. Sun bayar da rahoton cewa duk jiyya suna iya hana haɓakar ƙwayoyin kansa. Sun hana kwayoyin cutar kansa yaduwa ta hanyar kamuwa da kwayoyin a matakai daban-daban da kuma gabatar da apoptosis.

(2) Zai iya taimakawa wajen yaƙar damuwa da gajiya
Urolithin B ya mallaki kyawawan abubuwan antioxidant ta hanyar rage matakan jinsin oxygen da maganin peroxidation na lipid a wasu nau'ikan kwayar halitta. Babban matakan ROS suna haɗuwa da cuta da yawa kamar cutar Alzheimer.

A cikin binciken tare da ƙwayoyin neuronal waɗanda aka fallasa ga damuwa na oxidative, an samar da ƙarin urolithin B har ma da urolithin A don kare sel daga iskar shaka saboda haka ya kara yawan kwayar.

(3) Urolithin B cikin haɓaka ƙwaƙwalwa
Urolithin b an bayar da rahoton inganta haɓakar shinge na jini. Wannan yana haɓaka aikin sani.

Nazarin ya nuna cewa urolithin B na iya zama mai iya inganta ƙwaƙwalwar ajiya ta hanyar inganta aikin hankali gaba ɗaya.

(4) Yana hana zubar tsoka
Rashin tsoka na iya faruwa saboda dalilai daban-daban kamar rikice-rikice, tsufa da karancin furotin a cikin abincin. Yawancin matakai don dakatarwa, iyakance ko mafi kyau hana asarar tsoka ciki har da, motsa jiki, kwayoyi da amino acid da polyphenols za a iya aiki.

Urolithins ana iya rarrabe su azaman polyphenols kuma suna taka rawa wajen hana asarar tsoka ta hanyar kunna ƙwayoyin furotin na tsoka da kuma rage rage lalacewa.

A cikin binciken tare da mice, an gano abubuwan Urolithin B na tsawon lokaci don haɓaka haɓakar ƙwaƙwalwar su kamar yadda aka ga tsokoki sun fi girma.

(5) Urolithin B yana yaƙi da kumburi
Urolithin B ya mallaki kaddarorin anti-kumburi ta rage yawancin alamomin kumburi.

A cikin nazarin berayen da ke haifar da kumburin ciki na koda, an gano urolithin B don rage raunin koda. Ya haɓaka aikin na koda, ilimin halittar koda da rage alamun alamun rauni. Wannan yana nuna cewa UB ya iya rage kumburin koda.

(6) Fa'idodin haɗin gwiwar urolithin A da B
Hakanan an bayar da rahoton tasirin synergistic a cikin haɗuwa da urolithin A da B a cikin aikin fahimi da iyawa. Binciken ya bayyana cewa ana iya amfani da wannan hadin wajen magance ko hana cututtukan da suka shafi tabin hankali irin su damuwa ko cutar Alzheimer.

Sauran fa'idodin da ke hade da urolithins sune;

  • neuroprotection
  • Ameliorates ciwo na rayuwa

 

Urolithin A da kayan abinci na B

Urolithins ba a san ana iya samo shi ta halitta a kowane tushen abinci ba. Su samfuri ne na canji na ellagic acid wanda aka samo daga ellagitannins. Ellagitannins an canza shi zuwa acid ellagic ta gut microbiota kuma ana kara inganta ellagic acid a cikin metabolites din (urolithins) a cikin manyan hanji.

Ellagitannins na faruwa ne ta hanyar abinci kamar su rumman, 'ya'yan itace ciki har da strawberries, raspberries, girgije da baƙi, muscadine inabi, almond, guavas, shayi, da kwayoyi kamar gyada da kirji da giya mai tsufa misali ruwan inabi da wuski daga ganyen itacen oak.

Don haka zamu iya kammala abinci da abinci na urolithin B sune abinci mai wadataccen ellagitannin. Ya kamata a lura cewa ellagitannin bioavailability yana da iyakantacce yayin da kwayarsa ta biyu (urolithins) ke samuwa a sauƙaƙe.

Urolithins fitarwa da samarwa sun bambanta tsakanin mutane tunda tuba daga ellagitannins sun dogara da microbiota a cikin hanji. Akwai takamaiman kwayoyin cuta da ke cikin wannan jujjuyawar kuma sun bambanta tsakanin mutane inda wasu ke da babban, ƙarancin ko babu wadataccen microbiota. Hakanan hanyoyin abinci sun bambanta a matakan ellagitannins. Saboda haka fa'idodi masu amfani na ellagitannins sun bambanta daga mutum ɗaya zuwa wancan.

 

Rolarin Urolithin A da B

Rolarin Urolithin A da na Urolithin B ana samun su a kasuwa a matsayin kayan abinci mai wadataccen ellagitannin. Urolithin Ana samun wadatar kari. Mafi yawan abubuwan rumman an sayar dasu sosai kuma anyi amfani dasu tare da nasara. Ana hada wadannan kari daga 'ya'yan itacen ko kwaya kuma an tsara su cikin ruwa ko hoda.

Saboda bambance-bambancen da ke cikin tattarawar ellagitannins a cikin abinci daban-daban, abokan cinikin urolithin sun saya shi suna la'akari da tushen abinci. Hakanan ya shafi lokacin samowa don urolithin B foda ko kari na ruwa.

Fewan binciken karatun ɗan adam da aka gudanar tare da urolithin A foda ko B ba su bayar da rahoton wani mummunan sakamako mai illa daga gudanar da waɗannan abubuwan ƙarin ba.

reference

  1. Garcia-Muñoz, Cristina; Vaillant, Fabrice (2014-12-02). "Ƙaddarar Metabolic na Ellagitannins: Tasirin Lafiya, da Ra'ayoyin Bincike don Abincin Aiki Mai Aiki". Bayani mai mahimmanci a Kimiyyar Abinci da Gina Jiki.
  2. Bialonska D, Kasimsetty SG, Khan SI, Ferreira D (11 Nuwamba 2009). "Urolithins, metabolites microbial metabolites na Pomegranate ellagitannins, suna nuna aikin antioxidant mai ƙarfi a cikin gwajin tushen sel". J Agric Abincin Chem.
  3. Bodwell, Graham; Pottie, Ian; Nandaluru, Penchal (2011). "Ƙaƙƙarfan Wutar Lantarki-Buƙatar Diels-Alder-based Total Synthesis of Urolithin M7".

 

Samu farashi mai yawa