Urolithin B foda

Nuwamba 9, 2020

Cofttek shine mafi kyawun masana'antar foda Urolithin B a China. Masana'antarmu tana da cikakken tsarin sarrafa sarrafawa (ISO9001 & ISO14001), tare da damar samarwa kowane wata na 200kg.

 


Status: A Mass Production
Naúra: 1kg / jaka, 25kg / Drum

Urolithin BSfasali

name: Urolithin B.
Chemical Name: 3-Hydroxy-6H-dibenzo [b, d] pyran-6-daya
CAS: 1139-83-9
Tsarin Kiba: C13H8O3
Girman kwayoyin halitta: 212.2 g / mol
Color:  White foda
Makullin InChi: WXUQMTRHPNOXBV-UHFFFAOYSA-N
Lambar ta SMILES: O=C1C2=CC=CC=C2C3=CC=C(O)C=C3O1
aiki: Urolithin B na iya haɓaka aikin mitochondrial da aikin tsoka.

Urolithin B na iya inganta ƙarfin tsoka da juriya yayin tsufa.

Application: Urolithin B shine ƙwayar ƙwayar ƙwayar ƙwayar cuta na hanji na ellagitannis kuma yana nuna ƙarfin anti-oxidant da ayyukan pro-oxidant dangane da tsarin assay da yanayin. Urolithin B zai iya nuna aikin estrogenic da / ko anti-estrogenic aiki.
Solubility: Sauƙaƙa mai narkewa a cikin N, N-dimethylformamide da dimethylmethylene. Sulfone, dan kadan mai narkewa a methanol, ethanol, da acylate ethyl
Ajiye Temp: Hygroscopic, -20 ° C Freezer, A ƙarƙashin yanayin yanayi
Yanayin Jira: An shigo da su a ƙarƙashin zazzabi mai zafi azaman ƙwayoyin ƙwayoyi marasa haɗari. Wannan samfurin yana da ƙidayar isa ga 'yan makonni a yayin aikawa na kyauta da lokacin da aka kashe a Kwastam.

 

Urolithin B. Bayanin NMR

Urolithin B (1139-83-9) - NMR Bakan

 

Idan kuna buƙatar COA, MSDS, HNMR don kowane samfurin samfur da sauran bayanai, da fatan za a tuntuɓi mu manajan talla.