Urolithin B (1139-83-9 factory masana'antar kera kaya

Urolithin B

Nuwamba 9, 2020

Urolithin BSfasali

name: Urolithin B
Chemical Name: 3-Hydroxy-6H-dibenzo [b, d] pyran-6-daya
CAS: 1139-83-9
Tsarin Kiba: C13H8O3
Girman kwayoyin halitta: 212.2 g / mol
Color:  White foda
Makullin InChi: WXUQMTRHPNOXBV-UHFFFAOYSA-N
Lambar ta SMILES: O=C1C2=CC=CC=C2C3=CC=C(O)C=C3O1
aiki: Urolithin B na iya haɓaka aikin mitochondrial da aikin tsoka.

Urolithin B na iya inganta ƙarfin tsoka da juriya yayin tsufa.

Application: Urolithin B shine ƙwayar ƙwayar ƙwayar ƙwayar cuta na hanji na ellagitannis kuma yana nuna ƙarfin anti-oxidant da ayyukan pro-oxidant dangane da tsarin assay da yanayin. Urolithin B zai iya nuna aikin estrogenic da / ko anti-estrogenic aiki.
Solubility: Sauƙaƙa mai narkewa a cikin N, N-dimethylformamide da dimethylmethylene. Sulfone, dan kadan mai narkewa a methanol, ethanol, da acylate ethyl
Ajiye Temp: Hygroscopic, -20 ° C Freezer, A ƙarƙashin yanayin yanayi
Yanayin Jira: An shigo da su a ƙarƙashin zazzabi mai zafi azaman ƙwayoyin ƙwayoyi marasa haɗari. Wannan samfurin yana da ƙidayar isa ga 'yan makonni a yayin aikawa na kyauta da lokacin da aka kashe a Kwastam.